C12H11BrO4 — CID 117481511
2-(3-bromo-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-2-oxoacetic acid (PubChem CID 117481511) has the molecular formula C12H11BrO4 and a molecular weight of 299.12 g/mol. Its IUPAC name is 2-(3-bromo-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-2-oxoacetic acid.
| Compound Name | 2-(3-bromo-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 117481511 |
| Molecular Formula | C12H11BrO4 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 2-(3-bromo-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)c1c(O)c(Br)cc2c1CCCC2 |
| InChI | InChI=1S/C12H11BrO4/c13-8-5-6-3-1-2-4-7(6)9(10(8)14)11(15)12(16)17/h5,14H,1-4H2,(H,16,17) |
| InChIKey | GWVXGXQZOHUSCN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|