2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid

C12H11BrO4 — CID 117481526

IUPAC2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid
SMILESO=C(O)CC1(c2ccc(Br)c3c2OCO3)CC1
InChIInChI=1S/C12H11BrO4/c13-8-2-1-7(10-11(8)17-6-16-10)12(3-4-12)5-9(14)15/h1-2H,3-6H2,(H,14,15)
InChIKeyKQKPACDWOOAIIB-UHFFFAOYSA-N
MW299.12 g/mol
LogP2.68
Rot. Bonds3

About 2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid

2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid (PubChem CID 117481526) has the molecular formula C12H11BrO4 and a molecular weight of 299.12 g/mol. Its IUPAC name is 2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid.

Molecular Properties

Compound Name2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid
PubChem CID117481526
Molecular FormulaC12H11BrO4
Molecular Weight299.12 g/mol
Exact Mass297.98
IUPAC Name2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid
SMILESO=C(O)CC1(c2ccc(Br)c3c2OCO3)CC1
InChIInChI=1S/C12H11BrO4/c13-8-2-1-7(10-11(8)17-6-16-10)12(3-4-12)5-9(14)15/h1-2H,3-6H2,(H,14,15)
InChIKeyKQKPACDWOOAIIB-UHFFFAOYSA-N
XLogP2.68
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.12
LogP ≤ 52.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid?
The IUPAC name of 2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid (CID 117481526) is 2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid.
What is the SMILES notation for 2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid?
The canonical SMILES for 2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid is O=C(O)CC1(c2ccc(Br)c3c2OCO3)CC1.
What is the InChIKey of 2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid?
The InChIKey is KQKPACDWOOAIIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrO4/c13-8-2-1-7(10-11(8)17-6-16-10)12(3-4-12)5-9(14)15/h1-2H,3-6H2,(H,14,15).
What are the key properties of 2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid?
2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid has a molecular weight of 299.12 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(7-bromo-1,3-benzodioxol-4-yl)cyclopropyl]acetic acid is sourced from PubChem (CID 117481526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).