C14H12F3NO3 — CID 117482111
7-(1-isocyanatocyclobutyl)-6-(trifluoromethyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 117482111) has the molecular formula C14H12F3NO3 and a molecular weight of 299.25 g/mol. Its IUPAC name is 7-(1-isocyanatocyclobutyl)-6-(trifluoromethyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 7-(1-isocyanatocyclobutyl)-6-(trifluoromethyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 117482111 |
| Molecular Formula | C14H12F3NO3 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 7-(1-isocyanatocyclobutyl)-6-(trifluoromethyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | O=C=NC1(c2cc3c(cc2C(F)(F)F)OCCO3)CCC1 |
| InChI | InChI=1S/C14H12F3NO3/c15-14(16,17)10-7-12-11(20-4-5-21-12)6-9(10)13(18-8-19)2-1-3-13/h6-7H,1-5H2 |
| InChIKey | APWNGJGHCLUQRW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|