C13H17NO5S — CID 117482244
4-amino-4-[2-(1,1-dioxothietan-3-yl)oxyphenyl]butanoic acid (PubChem CID 117482244) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is 4-amino-4-[2-(1,1-dioxothietan-3-yl)oxyphenyl]butanoic acid.
| Compound Name | 4-amino-4-[2-(1,1-dioxothietan-3-yl)oxyphenyl]butanoic acid |
|---|---|
| PubChem CID | 117482244 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4-amino-4-[2-(1,1-dioxothietan-3-yl)oxyphenyl]butanoic acid |
| SMILES | NC(CCC(=O)O)c1ccccc1OC1CS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17NO5S/c14-11(5-6-13(15)16)10-3-1-2-4-12(10)19-9-7-20(17,18)8-9/h1-4,9,11H,5-8,14H2,(H,15,16) |
| InChIKey | VYWUBXXRJVFQEC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |