C13H18BrNO2 — CID 117483454
3-bromo-5-methyl-4-(piperidin-2-ylmethyl)benzene-1,2-diol (PubChem CID 117483454) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is 3-bromo-5-methyl-4-(piperidin-2-ylmethyl)benzene-1,2-diol.
| Compound Name | 3-bromo-5-methyl-4-(piperidin-2-ylmethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 117483454 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 3-bromo-5-methyl-4-(piperidin-2-ylmethyl)benzene-1,2-diol |
| SMILES | Cc1cc(O)c(O)c(Br)c1CC1CCCCN1 |
| InChI | InChI=1S/C13H18BrNO2/c1-8-6-11(16)13(17)12(14)10(8)7-9-4-2-3-5-15-9/h6,9,15-17H,2-5,7H2,1H3 |
| InChIKey | UAKNIVZEHOCXDE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|