C19H32O2 — CID 11748373
2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3-dioxolane (PubChem CID 11748373) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3-dioxolane.
| Compound Name | 2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 11748373 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,3-dioxolane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC1OCCO1 |
| InChI | InChI=1S/C19H32O2/c1-16(2)8-5-9-17(3)10-6-11-18(4)12-7-13-19-20-14-15-21-19/h8,10,12,19H,5-7,9,11,13-15H2,1-4H3/b17-10+,18-12+ |
| InChIKey | IZMDWRJUQTVQFM-VZRGJMDUSA-N |
| XLogP | 5.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|