C13H18BrNO2 — CID 117483768
2-(3-bromo-2-methoxy-4,6-dimethylphenyl)morpholine (PubChem CID 117483768) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is 2-(3-bromo-2-methoxy-4,6-dimethylphenyl)morpholine.
| Compound Name | 2-(3-bromo-2-methoxy-4,6-dimethylphenyl)morpholine |
|---|---|
| PubChem CID | 117483768 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-(3-bromo-2-methoxy-4,6-dimethylphenyl)morpholine |
| SMILES | COc1c(Br)c(C)cc(C)c1C1CNCCO1 |
| InChI | InChI=1S/C13H18BrNO2/c1-8-6-9(2)12(14)13(16-3)11(8)10-7-15-4-5-17-10/h6,10,15H,4-5,7H2,1-3H3 |
| InChIKey | UIUVXDFJCHSWEM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |