C14H19BrFN — CID 117483815
1-(5-bromo-2-fluoro-3,6-dimethylphenyl)cyclohexan-1-amine (PubChem CID 117483815) has the molecular formula C14H19BrFN and a molecular weight of 300.21 g/mol. Its IUPAC name is 1-(5-bromo-2-fluoro-3,6-dimethylphenyl)cyclohexan-1-amine.
| Compound Name | 1-(5-bromo-2-fluoro-3,6-dimethylphenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 117483815 |
| Molecular Formula | C14H19BrFN |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 1-(5-bromo-2-fluoro-3,6-dimethylphenyl)cyclohexan-1-amine |
| SMILES | Cc1cc(Br)c(C)c(C2(N)CCCCC2)c1F |
| InChI | InChI=1S/C14H19BrFN/c1-9-8-11(15)10(2)12(13(9)16)14(17)6-4-3-5-7-14/h8H,3-7,17H2,1-2H3 |
| InChIKey | WSJWWWLKXFPFSQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |