C17H17F3O — CID 11748406
[(2R)-4-(cyclohexen-1-yl)-1,1,1-trifluorobut-3-yn-2-yl]oxymethylbenzene (PubChem CID 11748406) has the molecular formula C17H17F3O and a molecular weight of 294.32 g/mol. Its IUPAC name is [(2R)-4-(cyclohexen-1-yl)-1,1,1-trifluorobut-3-yn-2-yl]oxymethylbenzene.
| Compound Name | [(2R)-4-(cyclohexen-1-yl)-1,1,1-trifluorobut-3-yn-2-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 11748406 |
| Molecular Formula | C17H17F3O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | [(2R)-4-(cyclohexen-1-yl)-1,1,1-trifluorobut-3-yn-2-yl]oxymethylbenzene |
| SMILES | FC(F)(F)[C@@H](C#CC1=CCCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C17H17F3O/c18-17(19,20)16(12-11-14-7-3-1-4-8-14)21-13-15-9-5-2-6-10-15/h2,5-7,9-10,16H,1,3-4,8,13H2/t16-/m1/s1 |
| InChIKey | HWRBYAZDKFJPMD-MRXNPFEDSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|