C16H22O5 — CID 11748412
(1S,4R,12R)-7-(2-hydroxyethoxy)-9,9,12-trimethyl-2-oxatricyclo[6.3.1.04,12]dodec-7-ene-3,6-dione (PubChem CID 11748412) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is (1S,4R,12R)-7-(2-hydroxyethoxy)-9,9,12-trimethyl-2-oxatricyclo[6.3.1.04,12]dodec-7-ene-3,6-dione.
| Compound Name | (1S,4R,12R)-7-(2-hydroxyethoxy)-9,9,12-trimethyl-2-oxatricyclo[6.3.1.04,12]dodec-7-ene-3,6-dione |
|---|---|
| PubChem CID | 11748412 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (1S,4R,12R)-7-(2-hydroxyethoxy)-9,9,12-trimethyl-2-oxatricyclo[6.3.1.04,12]dodec-7-ene-3,6-dione |
| SMILES | CC1(C)CC[C@@H]2OC(=O)[C@@H]3CC(=O)C(OCCO)=C1[C@]23C |
| InChI | InChI=1S/C16H22O5/c1-15(2)5-4-11-16(3)9(14(19)21-11)8-10(18)12(13(15)16)20-7-6-17/h9,11,17H,4-8H2,1-3H3/t9-,11-,16-/m0/s1 |
| InChIKey | PKKAFNWZKFUMIS-QEKSWQHZSA-N |
| XLogP | 1.59 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |