C16H22O5 — CID 11748413
methyl (2R)-2-[(2S,4aS,8S,8aR)-4a,8-dimethyl-1,5-dioxo-3,4,8,8a-tetrahydro-2H-naphthalen-2-yl]-2-hydroxypropanoate (PubChem CID 11748413) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl (2R)-2-[(2S,4aS,8S,8aR)-4a,8-dimethyl-1,5-dioxo-3,4,8,8a-tetrahydro-2H-naphthalen-2-yl]-2-hydroxypropanoate.
| Compound Name | methyl (2R)-2-[(2S,4aS,8S,8aR)-4a,8-dimethyl-1,5-dioxo-3,4,8,8a-tetrahydro-2H-naphthalen-2-yl]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 11748413 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | methyl (2R)-2-[(2S,4aS,8S,8aR)-4a,8-dimethyl-1,5-dioxo-3,4,8,8a-tetrahydro-2H-naphthalen-2-yl]-2-hydroxypropanoate |
| SMILES | COC(=O)[C@](C)(O)[C@@H]1CC[C@]2(C)C(=O)C=C[C@H](C)[C@H]2C1=O |
| InChI | InChI=1S/C16H22O5/c1-9-5-6-11(17)15(2)8-7-10(13(18)12(9)15)16(3,20)14(19)21-4/h5-6,9-10,12,20H,7-8H2,1-4H3/t9-,10+,12-,15+,16+/m0/s1 |
| InChIKey | YALXCFHMIDNEDU-JXNBKPOHSA-N |
| XLogP | 1.29 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |