C16H15NO5 — CID 117485393
3-(2,6-dimethyl-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-yl)-1,2-oxazole-5-carboxylic acid (PubChem CID 117485393) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is 3-(2,6-dimethyl-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-yl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(2,6-dimethyl-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-yl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117485393 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3-(2,6-dimethyl-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-yl)-1,2-oxazole-5-carboxylic acid |
| SMILES | CC1Cc2c(cc3c(c2-c2cc(C(=O)O)on2)OC(C)C3)O1 |
| InChI | InChI=1S/C16H15NO5/c1-7-3-9-5-12-10(4-8(2)20-12)14(15(9)21-7)11-6-13(16(18)19)22-17-11/h5-8H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | AJZDZUZUDXESGJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |