C14H14F3NO3 — CID 11748612
(2S,3S)-2-methyl-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoic acid (PubChem CID 11748612) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is (2S,3S)-2-methyl-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoic acid.
| Compound Name | (2S,3S)-2-methyl-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 11748612 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (2S,3S)-2-methyl-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoic acid |
| SMILES | C=C[C@@H](c1ccccc1)[C@](C)(NC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C14H14F3NO3/c1-3-10(9-7-5-4-6-8-9)13(2,12(20)21)18-11(19)14(15,16)17/h3-8,10H,1H2,2H3,(H,18,19)(H,20,21)/t10-,13-/m0/s1 |
| InChIKey | APFVTNIUAGTBRJ-GWCFXTLKSA-N |
| XLogP | 2.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|