C17H24N2O3 — CID 11748727
N-benzyl-1-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]methanimine oxide (PubChem CID 11748727) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-benzyl-1-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]methanimine oxide.
| Compound Name | N-benzyl-1-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]methanimine oxide |
|---|---|
| PubChem CID | 11748727 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-benzyl-1-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]methanimine oxide |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1/C=[N+](\[O-])Cc1ccccc1 |
| InChI | InChI=1S/C17H24N2O3/c1-17(2,3)22-16(20)19-11-7-10-15(19)13-18(21)12-14-8-5-4-6-9-14/h4-6,8-9,13,15H,7,10-12H2,1-3H3/b18-13-/t15-/m0/s1 |
| InChIKey | JIUQPCYGCGOSCH-LUJRCDHRSA-N |
| XLogP | 3.17 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|