C19H30N2O — CID 117487419
1-[2-(2-cyclopentyloxy-3,4-dimethylphenyl)ethyl]piperazine (PubChem CID 117487419) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-[2-(2-cyclopentyloxy-3,4-dimethylphenyl)ethyl]piperazine.
| Compound Name | 1-[2-(2-cyclopentyloxy-3,4-dimethylphenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 117487419 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 1-[2-(2-cyclopentyloxy-3,4-dimethylphenyl)ethyl]piperazine |
| SMILES | Cc1ccc(CCN2CCNCC2)c(OC2CCCC2)c1C |
| InChI | InChI=1S/C19H30N2O/c1-15-7-8-17(9-12-21-13-10-20-11-14-21)19(16(15)2)22-18-5-3-4-6-18/h7-8,18,20H,3-6,9-14H2,1-2H3 |
| InChIKey | ANMGEWRPOFELIT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |