C15H20F3NO2 — CID 117488350
1-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]cyclohexan-1-amine (PubChem CID 117488350) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is 1-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]cyclohexan-1-amine.
| Compound Name | 1-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 117488350 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]cyclohexan-1-amine |
| SMILES | COc1cc(C(F)(F)F)c(C2(N)CCCCC2)cc1OC |
| InChI | InChI=1S/C15H20F3NO2/c1-20-12-8-10(14(19)6-4-3-5-7-14)11(15(16,17)18)9-13(12)21-2/h8-9H,3-7,19H2,1-2H3 |
| InChIKey | MGZCDOWTANUDTI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |