C10H22O10S2 — CID 11748893
(2S,3S)-4-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]butane-1,2,3-triol;methyl sulfate (PubChem CID 11748893) has the molecular formula C10H22O10S2 and a molecular weight of 366.41 g/mol. Its IUPAC name is (2S,3S)-4-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]butane-1,2,3-triol;methyl sulfate.
| Compound Name | (2S,3S)-4-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]butane-1,2,3-triol;methyl sulfate |
|---|---|
| PubChem CID | 11748893 |
| Molecular Formula | C10H22O10S2 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (2S,3S)-4-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]butane-1,2,3-triol;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].OC[C@@H]1[C@@H](O)[C@H](O)C[S+]1C[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C9H19O6S.CH4O4S/c10-1-5(12)6(13)3-16-4-7(14)9(15)8(16)2-11;1-5-6(2,3)4/h5-15H,1-4H2;1H3,(H,2,3,4)/q+1;/p-1/t5-,6+,7+,8+,9-,16?;/m0./s1 |
| InChIKey | GYKFDZDHLRTCTA-BBRMXRFLSA-M |
| XLogP | -4.49 |
| TPSA | 187.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | -4.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|