C18H28N2O2 — CID 117489930
2-[[3-methoxy-4-(1-methylpyrrolidin-3-yl)oxyphenyl]methyl]piperidine (PubChem CID 117489930) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-[[3-methoxy-4-(1-methylpyrrolidin-3-yl)oxyphenyl]methyl]piperidine.
| Compound Name | 2-[[3-methoxy-4-(1-methylpyrrolidin-3-yl)oxyphenyl]methyl]piperidine |
|---|---|
| PubChem CID | 117489930 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-[[3-methoxy-4-(1-methylpyrrolidin-3-yl)oxyphenyl]methyl]piperidine |
| SMILES | COc1cc(CC2CCCCN2)ccc1OC1CCN(C)C1 |
| InChI | InChI=1S/C18H28N2O2/c1-20-10-8-16(13-20)22-17-7-6-14(12-18(17)21-2)11-15-5-3-4-9-19-15/h6-7,12,15-16,19H,3-5,8-11,13H2,1-2H3 |
| InChIKey | ZZLBAVRPPGUUMV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |