C10H7BrF2N2O2 — CID 117490147
4-(5-bromo-2,3-difluoro-4-methoxyphenyl)-1,2-oxazol-5-amine (PubChem CID 117490147) has the molecular formula C10H7BrF2N2O2 and a molecular weight of 305.08 g/mol. Its IUPAC name is 4-(5-bromo-2,3-difluoro-4-methoxyphenyl)-1,2-oxazol-5-amine.
| Compound Name | 4-(5-bromo-2,3-difluoro-4-methoxyphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117490147 |
| Molecular Formula | C10H7BrF2N2O2 |
| Molecular Weight | 305.08 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 4-(5-bromo-2,3-difluoro-4-methoxyphenyl)-1,2-oxazol-5-amine |
| SMILES | COc1c(Br)cc(-c2cnoc2N)c(F)c1F |
| InChI | InChI=1S/C10H7BrF2N2O2/c1-16-9-6(11)2-4(7(12)8(9)13)5-3-15-17-10(5)14/h2-3H,14H2,1H3 |
| InChIKey | IDOPJBFYPXRAJN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.08 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|