C15H19N3O4 — CID 117490624
4-amino-4-[2-(4-methyl-3,5-dioxopiperazin-1-yl)phenyl]butanoic acid (PubChem CID 117490624) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-amino-4-[2-(4-methyl-3,5-dioxopiperazin-1-yl)phenyl]butanoic acid.
| Compound Name | 4-amino-4-[2-(4-methyl-3,5-dioxopiperazin-1-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 117490624 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-amino-4-[2-(4-methyl-3,5-dioxopiperazin-1-yl)phenyl]butanoic acid |
| SMILES | CN1C(=O)CN(c2ccccc2C(N)CCC(=O)O)CC1=O |
| InChI | InChI=1S/C15H19N3O4/c1-17-13(19)8-18(9-14(17)20)12-5-3-2-4-10(12)11(16)6-7-15(21)22/h2-5,11H,6-9,16H2,1H3,(H,21,22) |
| InChIKey | IGWRKHMRANOKIB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|