C16H19NO3S — CID 117490743
3-[4-(1-isocyanatocyclopentyl)-2-methoxyphenoxy]thietane (PubChem CID 117490743) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is 3-[4-(1-isocyanatocyclopentyl)-2-methoxyphenoxy]thietane.
| Compound Name | 3-[4-(1-isocyanatocyclopentyl)-2-methoxyphenoxy]thietane |
|---|---|
| PubChem CID | 117490743 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 3-[4-(1-isocyanatocyclopentyl)-2-methoxyphenoxy]thietane |
| SMILES | COc1cc(C2(N=C=O)CCCC2)ccc1OC1CSC1 |
| InChI | InChI=1S/C16H19NO3S/c1-19-15-8-12(16(17-11-18)6-2-3-7-16)4-5-14(15)20-13-9-21-10-13/h4-5,8,13H,2-3,6-7,9-10H2,1H3 |
| InChIKey | FQYRNKDLZVVUQV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|