C17H27N3O2 — CID 117490854
4-amino-4-[3-(4-propan-2-ylpiperazin-1-yl)phenyl]butanoic acid (PubChem CID 117490854) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-amino-4-[3-(4-propan-2-ylpiperazin-1-yl)phenyl]butanoic acid.
| Compound Name | 4-amino-4-[3-(4-propan-2-ylpiperazin-1-yl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 117490854 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 4-amino-4-[3-(4-propan-2-ylpiperazin-1-yl)phenyl]butanoic acid |
| SMILES | CC(C)N1CCN(c2cccc(C(N)CCC(=O)O)c2)CC1 |
| InChI | InChI=1S/C17H27N3O2/c1-13(2)19-8-10-20(11-9-19)15-5-3-4-14(12-15)16(18)6-7-17(21)22/h3-5,12-13,16H,6-11,18H2,1-2H3,(H,21,22) |
| InChIKey | WKDGCPBKNSLFKI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |