C19H26N4O4 — CID 11749160
pentyl 4-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methoxy]piperidine-1-carboxylate (PubChem CID 11749160) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is pentyl 4-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methoxy]piperidine-1-carboxylate.
| Compound Name | pentyl 4-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11749160 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | pentyl 4-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methoxy]piperidine-1-carboxylate |
| SMILES | CCCCCOC(=O)N1CCC(OCc2nc(-c3ccncc3)no2)CC1 |
| InChI | InChI=1S/C19H26N4O4/c1-2-3-4-13-25-19(24)23-11-7-16(8-12-23)26-14-17-21-18(22-27-17)15-5-9-20-10-6-15/h5-6,9-10,16H,2-4,7-8,11-14H2,1H3 |
| InChIKey | WCPLTENBUOOQIQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 90.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|