C22H30O5 — CID 11749167
(5S,8R)-8-[(2S,3R)-3-[(3E,5R,6S)-5-hydroxy-6,7-dimethyl-2-methylideneocta-3,7-dienyl]oxiran-2-yl]-5-methyl-6-methylideneoxocane-2,4-dione (PubChem CID 11749167) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is (5S,8R)-8-[(2S,3R)-3-[(3E,5R,6S)-5-hydroxy-6,7-dimethyl-2-methylideneocta-3,7-dienyl]oxiran-2-yl]-5-methyl-6-methylideneoxocane-2,4-dione.
| Compound Name | (5S,8R)-8-[(2S,3R)-3-[(3E,5R,6S)-5-hydroxy-6,7-dimethyl-2-methylideneocta-3,7-dienyl]oxiran-2-yl]-5-methyl-6-methylideneoxocane-2,4-dione |
|---|---|
| PubChem CID | 11749167 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (5S,8R)-8-[(2S,3R)-3-[(3E,5R,6S)-5-hydroxy-6,7-dimethyl-2-methylideneocta-3,7-dienyl]oxiran-2-yl]-5-methyl-6-methylideneoxocane-2,4-dione |
| SMILES | C=C(/C=C/[C@@H](O)[C@@H](C)C(=C)C)C[C@H]1O[C@@H]1[C@H]1CC(=C)[C@H](C)C(=O)CC(=O)O1 |
| InChI | InChI=1S/C22H30O5/c1-12(2)15(5)17(23)8-7-13(3)9-19-22(27-19)20-10-14(4)16(6)18(24)11-21(25)26-20/h7-8,15-17,19-20,22-23H,1,3-4,9-11H2,2,5-6H3/b8-7+/t15-,16-,17+,19+,20+,22-/m0/s1 |
| InChIKey | CBPXPFBBJJIRDM-POAHUOCNSA-N |
| XLogP | 3.30 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|