C16H21NO5 — CID 117492320
2-[1-[4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]cyclopropyl]acetic acid (PubChem CID 117492320) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[1-[4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 117492320 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-[1-[4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]cyclopropyl]acetic acid |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C2(CC(=O)O)CC2)ccc1O |
| InChI | InChI=1S/C16H21NO5/c1-15(2,3)22-14(21)17-11-8-10(4-5-12(11)18)16(6-7-16)9-13(19)20/h4-5,8,18H,6-7,9H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | IWHOSLNCKMCXLS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|