C18H21N5 — CID 117492414
1-methyl-4-(9-methyl-9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)pyrazol-5-amine (PubChem CID 117492414) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-methyl-4-(9-methyl-9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)pyrazol-5-amine.
| Compound Name | 1-methyl-4-(9-methyl-9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)pyrazol-5-amine |
|---|---|
| PubChem CID | 117492414 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 1-methyl-4-(9-methyl-9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)pyrazol-5-amine |
| SMILES | Cn1ncc(-c2ccc3c(c2)c2c(n3C)N3CCC2CC3)c1N |
| InChI | InChI=1S/C18H21N5/c1-21-15-4-3-12(14-10-20-22(2)17(14)19)9-13(15)16-11-5-7-23(8-6-11)18(16)21/h3-4,9-11H,5-8,19H2,1-2H3 |
| InChIKey | ZARQIJOSJNCLAZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |