C16H24N2O4 — CID 117493374
3-amino-3-[4-methoxy-3-(1-methylpiperidin-3-yl)oxyphenyl]propanoic acid (PubChem CID 117493374) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-amino-3-[4-methoxy-3-(1-methylpiperidin-3-yl)oxyphenyl]propanoic acid.
| Compound Name | 3-amino-3-[4-methoxy-3-(1-methylpiperidin-3-yl)oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 117493374 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-amino-3-[4-methoxy-3-(1-methylpiperidin-3-yl)oxyphenyl]propanoic acid |
| SMILES | COc1ccc(C(N)CC(=O)O)cc1OC1CCCN(C)C1 |
| InChI | InChI=1S/C16H24N2O4/c1-18-7-3-4-12(10-18)22-15-8-11(5-6-14(15)21-2)13(17)9-16(19)20/h5-6,8,12-13H,3-4,7,9-10,17H2,1-2H3,(H,19,20) |
| InChIKey | JFKSYPZKSLVRPF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |