C23H44O2Si — CID 11749341
(Z)-7-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]-2-methylhept-6-en-2-ol (PubChem CID 11749341) has the molecular formula C23H44O2Si and a molecular weight of 380.69 g/mol. Its IUPAC name is (Z)-7-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]-2-methylhept-6-en-2-ol.
| Compound Name | (Z)-7-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]-2-methylhept-6-en-2-ol |
|---|---|
| PubChem CID | 11749341 |
| Molecular Formula | C23H44O2Si |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | (Z)-7-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]-2-methylhept-6-en-2-ol |
| SMILES | CC(C)(O)CCC/C=C\[C@]12CCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCC2 |
| InChI | InChI=1S/C23H44O2Si/c1-21(2,3)26(6,7)25-20-14-12-18-23(17-11-13-19(20)23)16-10-8-9-15-22(4,5)24/h10,16,19-20,24H,8-9,11-15,17-18H2,1-7H3/b16-10-/t19-,20+,23-/m0/s1 |
| InChIKey | AVCFKTUBKFJFEZ-ANFYDZPBSA-N |
| XLogP | 6.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|