C21H38O4Si — CID 11749390
tert-butyl-[(1R,2S,3R)-3-ethenyl-2-methoxy-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hex-5-ynoxy]-dimethylsilane (PubChem CID 11749390) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is tert-butyl-[(1R,2S,3R)-3-ethenyl-2-methoxy-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hex-5-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2S,3R)-3-ethenyl-2-methoxy-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hex-5-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11749390 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | tert-butyl-[(1R,2S,3R)-3-ethenyl-2-methoxy-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hex-5-ynoxy]-dimethylsilane |
| SMILES | C#CC[C@H](C=C)[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C21H38O4Si/c1-12-14-16(13-2)18(22-9)19(25-26(10,11)20(4,5)6)17-15(3)23-21(7,8)24-17/h1,13,15-19H,2,14H2,3-11H3/t15-,16+,17+,18+,19+/m1/s1 |
| InChIKey | TYSUMYFWDWTDIE-BCYZHJNNSA-N |
| XLogP | 4.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|