C15H19NO6 — CID 117494091
ethyl 2-[3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-2-oxoacetate (PubChem CID 117494091) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is ethyl 2-[3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-2-oxoacetate.
| Compound Name | ethyl 2-[3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-2-oxoacetate |
|---|---|
| PubChem CID | 117494091 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | ethyl 2-[3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cccc(O)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H19NO6/c1-5-21-13(19)12(18)9-7-6-8-10(17)11(9)16-14(20)22-15(2,3)4/h6-8,17H,5H2,1-4H3,(H,16,20) |
| InChIKey | SXDDGSQJTQHMOX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|