C13H15N3O4S — CID 117494110
4-[3-(1,1-dioxothietan-3-yl)oxy-4-methoxyphenyl]-1H-pyrazol-5-amine (PubChem CID 117494110) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 4-[3-(1,1-dioxothietan-3-yl)oxy-4-methoxyphenyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[3-(1,1-dioxothietan-3-yl)oxy-4-methoxyphenyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117494110 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-[3-(1,1-dioxothietan-3-yl)oxy-4-methoxyphenyl]-1H-pyrazol-5-amine |
| SMILES | COc1ccc(-c2cn[nH]c2N)cc1OC1CS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15N3O4S/c1-19-11-3-2-8(10-5-15-16-13(10)14)4-12(11)20-9-6-21(17,18)7-9/h2-5,9H,6-7H2,1H3,(H3,14,15,16) |
| InChIKey | DPNJQXLGZDCGPK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |