C20H27N5O3 — CID 11749475
6-[(8-hydroxyquinolin-5-yl)methyl]-1,4,8,11-tetrazacyclotetradecane-5,7-dione (PubChem CID 11749475) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 6-[(8-hydroxyquinolin-5-yl)methyl]-1,4,8,11-tetrazacyclotetradecane-5,7-dione.
| Compound Name | 6-[(8-hydroxyquinolin-5-yl)methyl]-1,4,8,11-tetrazacyclotetradecane-5,7-dione |
|---|---|
| PubChem CID | 11749475 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 6-[(8-hydroxyquinolin-5-yl)methyl]-1,4,8,11-tetrazacyclotetradecane-5,7-dione |
| SMILES | O=C1NCCNCCCNCCNC(=O)C1Cc1ccc(O)c2ncccc12 |
| InChI | InChI=1S/C20H27N5O3/c26-17-5-4-14(15-3-1-8-23-18(15)17)13-16-19(27)24-11-9-21-6-2-7-22-10-12-25-20(16)28/h1,3-5,8,16,21-22,26H,2,6-7,9-13H2,(H,24,27)(H,25,28) |
| InChIKey | INDPLHMIYDTYBM-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|