C16H22F3N5O3 — CID 11749590
N-[[4,4-dimethyl-1-[[[4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]cyclohexyl]methyl]-N-hydroxyformamide (PubChem CID 11749590) has the molecular formula C16H22F3N5O3 and a molecular weight of 389.38 g/mol. Its IUPAC name is N-[[4,4-dimethyl-1-[[[4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]cyclohexyl]methyl]-N-hydroxyformamide.
| Compound Name | N-[[4,4-dimethyl-1-[[[4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]cyclohexyl]methyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 11749590 |
| Molecular Formula | C16H22F3N5O3 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-[[4,4-dimethyl-1-[[[4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]cyclohexyl]methyl]-N-hydroxyformamide |
| SMILES | CC1(C)CCC(CN(O)C=O)(C(=O)NNc2nccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C16H22F3N5O3/c1-14(2)4-6-15(7-5-14,9-24(27)10-25)12(26)22-23-13-20-8-3-11(21-13)16(17,18)19/h3,8,10,27H,4-7,9H2,1-2H3,(H,22,26)(H,20,21,23) |
| InChIKey | RGTJZKKVSHGRED-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|