C15H19BrO2 — CID 117496068
1-(5-bromo-2-ethylphenyl)cyclohexane-1-carboxylic acid (PubChem CID 117496068) has the molecular formula C15H19BrO2 and a molecular weight of 311.22 g/mol. Its IUPAC name is 1-(5-bromo-2-ethylphenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(5-bromo-2-ethylphenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117496068 |
| Molecular Formula | C15H19BrO2 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 1-(5-bromo-2-ethylphenyl)cyclohexane-1-carboxylic acid |
| SMILES | CCc1ccc(Br)cc1C1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C15H19BrO2/c1-2-11-6-7-12(16)10-13(11)15(14(17)18)8-4-3-5-9-15/h6-7,10H,2-5,8-9H2,1H3,(H,17,18) |
| InChIKey | IPXADGKBGPZOGE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |