About 3-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-1-methylpyrazol-5-amine
3-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-1-methylpyrazol-5-amine (PubChem CID 117496199) has the molecular formula C17H17N3O3
and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-1-methylpyrazol-5-amine.
Molecular Properties
| Compound Name | 3-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-1-methylpyrazol-5-amine |
| PubChem CID | 117496199 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-1-methylpyrazol-5-amine |
| SMILES | COc1c2cc(C)oc2c(-c2cc(N)n(C)n2)c2cc(C)oc12 |
| InChI | InChI=1S/C17H17N3O3/c1-8-5-10-14(12-7-13(18)20(3)19-12)15-11(6-9(2)22-15)16(21-4)17(10)23-8/h5-7H,18H2,1-4H3 |
| InChIKey | DETBQCYTIMIDQY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-1-methylpyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-1-methylpyrazol-5-amine?
The IUPAC name of 3-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-1-methylpyrazol-5-amine (CID 117496199) is 3-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-1-methylpyrazol-5-amine.
What is the SMILES notation for 3-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-1-methylpyrazol-5-amine?
The canonical SMILES for 3-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-1-methylpyrazol-5-amine is COc1c2cc(C)oc2c(-c2cc(N)n(C)n2)c2cc(C)oc12.
What is the InChIKey of 3-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-1-methylpyrazol-5-amine?
The InChIKey is DETBQCYTIMIDQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O3/c1-8-5-10-14(12-7-13(18)20(3)19-12)15-11(6-9(2)22-15)16(21-4)17(10)23-8/h5-7H,18H2,1-4H3.
What are the key properties of 3-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-1-methylpyrazol-5-amine?
3-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-1-methylpyrazol-5-amine has a molecular weight of 311.34 g/mol, XLogP of 3.79, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-1-methylpyrazol-5-amine is sourced from PubChem (CID 117496199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).