About 5-[3-(1,1-dioxothietan-3-yl)oxyphenyl]pyrrolidine-3-carboxylic acid
5-[3-(1,1-dioxothietan-3-yl)oxyphenyl]pyrrolidine-3-carboxylic acid (PubChem CID 117496212) has the molecular formula C14H17NO5S
and a molecular weight of 311.36 g/mol. Its IUPAC name is 5-[3-(1,1-dioxothietan-3-yl)oxyphenyl]pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[3-(1,1-dioxothietan-3-yl)oxyphenyl]pyrrolidine-3-carboxylic acid |
| PubChem CID | 117496212 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 5-[3-(1,1-dioxothietan-3-yl)oxyphenyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CNC(c2cccc(OC3CS(=O)(=O)C3)c2)C1 |
| InChI | InChI=1S/C14H17NO5S/c16-14(17)10-5-13(15-6-10)9-2-1-3-11(4-9)20-12-7-21(18,19)8-12/h1-4,10,12-13,15H,5-8H2,(H,16,17) |
| InChIKey | VSPUZWARTHZYDZ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[3-(1,1-dioxothietan-3-yl)oxyphenyl]pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(1,1-dioxothietan-3-yl)oxyphenyl]pyrrolidine-3-carboxylic acid?
The IUPAC name of 5-[3-(1,1-dioxothietan-3-yl)oxyphenyl]pyrrolidine-3-carboxylic acid (CID 117496212) is 5-[3-(1,1-dioxothietan-3-yl)oxyphenyl]pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 5-[3-(1,1-dioxothietan-3-yl)oxyphenyl]pyrrolidine-3-carboxylic acid?
The canonical SMILES for 5-[3-(1,1-dioxothietan-3-yl)oxyphenyl]pyrrolidine-3-carboxylic acid is O=C(O)C1CNC(c2cccc(OC3CS(=O)(=O)C3)c2)C1.
What is the InChIKey of 5-[3-(1,1-dioxothietan-3-yl)oxyphenyl]pyrrolidine-3-carboxylic acid?
The InChIKey is VSPUZWARTHZYDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO5S/c16-14(17)10-5-13(15-6-10)9-2-1-3-11(4-9)20-12-7-21(18,19)8-12/h1-4,10,12-13,15H,5-8H2,(H,16,17).
What are the key properties of 5-[3-(1,1-dioxothietan-3-yl)oxyphenyl]pyrrolidine-3-carboxylic acid?
5-[3-(1,1-dioxothietan-3-yl)oxyphenyl]pyrrolidine-3-carboxylic acid has a molecular weight of 311.36 g/mol, XLogP of 0.60, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(1,1-dioxothietan-3-yl)oxyphenyl]pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 117496212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).