C22H41BO3Si — CID 11749685
tert-butyl-[(1S,2R,5S)-2-ethenyl-5-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]cyclopentyl]oxy-dimethylsilane (PubChem CID 11749685) has the molecular formula C22H41BO3Si and a molecular weight of 392.47 g/mol. Its IUPAC name is tert-butyl-[(1S,2R,5S)-2-ethenyl-5-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]cyclopentyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2R,5S)-2-ethenyl-5-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]cyclopentyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11749685 |
| Molecular Formula | C22H41BO3Si |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | tert-butyl-[(1S,2R,5S)-2-ethenyl-5-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]cyclopentyl]oxy-dimethylsilane |
| SMILES | C=C[C@H]1CC[C@@H](/C=C/CB2OC(C)(C)C(C)(C)O2)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H41BO3Si/c1-11-17-14-15-18(19(17)24-27(9,10)20(2,3)4)13-12-16-23-25-21(5,6)22(7,8)26-23/h11-13,17-19H,1,14-16H2,2-10H3/b13-12+/t17-,18+,19-/m0/s1 |
| InChIKey | IINGZIDPXRUFRU-BATDUODBSA-N |
| XLogP | 6.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|