C15H22BrNO — CID 117497403
2-[1-(aminomethyl)cyclohexyl]-6-bromo-3,5-dimethylphenol (PubChem CID 117497403) has the molecular formula C15H22BrNO and a molecular weight of 312.25 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclohexyl]-6-bromo-3,5-dimethylphenol.
| Compound Name | 2-[1-(aminomethyl)cyclohexyl]-6-bromo-3,5-dimethylphenol |
|---|---|
| PubChem CID | 117497403 |
| Molecular Formula | C15H22BrNO |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[1-(aminomethyl)cyclohexyl]-6-bromo-3,5-dimethylphenol |
| SMILES | Cc1cc(C)c(C2(CN)CCCCC2)c(O)c1Br |
| InChI | InChI=1S/C15H22BrNO/c1-10-8-11(2)13(16)14(18)12(10)15(9-17)6-4-3-5-7-15/h8,18H,3-7,9,17H2,1-2H3 |
| InChIKey | HUHDHJZMUKTWKC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |