C19H24N2O2 — CID 117497697
3-methyl-3-(9-methyl-9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)butanoic acid (PubChem CID 117497697) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 3-methyl-3-(9-methyl-9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)butanoic acid.
| Compound Name | 3-methyl-3-(9-methyl-9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)butanoic acid |
|---|---|
| PubChem CID | 117497697 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 3-methyl-3-(9-methyl-9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)butanoic acid |
| SMILES | Cn1c2c(c3cc(C(C)(C)CC(=O)O)ccc31)C1CCN2CC1 |
| InChI | InChI=1S/C19H24N2O2/c1-19(2,11-16(22)23)13-4-5-15-14(10-13)17-12-6-8-21(9-7-12)18(17)20(15)3/h4-5,10,12H,6-9,11H2,1-3H3,(H,22,23) |
| InChIKey | KNLSVXBAKQMZBY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |