C22H23ClN4O — CID 11749772
5-chloro-2-[7-(1-methoxybutan-2-yl)-10-methyl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-2-yl]benzonitrile (PubChem CID 11749772) has the molecular formula C22H23ClN4O and a molecular weight of 394.91 g/mol. Its IUPAC name is 5-chloro-2-[7-(1-methoxybutan-2-yl)-10-methyl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-2-yl]benzonitrile.
| Compound Name | 5-chloro-2-[7-(1-methoxybutan-2-yl)-10-methyl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 11749772 |
| Molecular Formula | C22H23ClN4O |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 5-chloro-2-[7-(1-methoxybutan-2-yl)-10-methyl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-2-yl]benzonitrile |
| SMILES | CCC(COC)N1CCc2cn(-c3ccc(Cl)cc3C#N)c3nc(C)cc1c23 |
| InChI | InChI=1S/C22H23ClN4O/c1-4-18(13-28-3)26-8-7-15-12-27(19-6-5-17(23)10-16(19)11-24)22-21(15)20(26)9-14(2)25-22/h5-6,9-10,12,18H,4,7-8,13H2,1-3H3 |
| InChIKey | WVEIWUCAVNCPIV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 54.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |