C21H27FN2O2 — CID 11749774
(3R,4S)-7-(dimethylamino)-4-[2-(4-fluorophenyl)ethylamino]-2,2-dimethyl-3,4-dihydrochromen-3-ol (PubChem CID 11749774) has the molecular formula C21H27FN2O2 and a molecular weight of 358.46 g/mol. Its IUPAC name is (3R,4S)-7-(dimethylamino)-4-[2-(4-fluorophenyl)ethylamino]-2,2-dimethyl-3,4-dihydrochromen-3-ol.
| Compound Name | (3R,4S)-7-(dimethylamino)-4-[2-(4-fluorophenyl)ethylamino]-2,2-dimethyl-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 11749774 |
| Molecular Formula | C21H27FN2O2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (3R,4S)-7-(dimethylamino)-4-[2-(4-fluorophenyl)ethylamino]-2,2-dimethyl-3,4-dihydrochromen-3-ol |
| SMILES | CN(C)c1ccc2c(c1)OC(C)(C)[C@H](O)[C@H]2NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H27FN2O2/c1-21(2)20(25)19(23-12-11-14-5-7-15(22)8-6-14)17-10-9-16(24(3)4)13-18(17)26-21/h5-10,13,19-20,23,25H,11-12H2,1-4H3/t19-,20+/m0/s1 |
| InChIKey | CAZPPJZHSDSOJJ-VQTJNVASSA-N |
| XLogP | 3.30 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|