C13H13BrO4 — CID 117498093
2-(2-bromo-3-hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl)-2-oxoacetic acid (PubChem CID 117498093) has the molecular formula C13H13BrO4 and a molecular weight of 313.15 g/mol. Its IUPAC name is 2-(2-bromo-3-hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl)-2-oxoacetic acid.
| Compound Name | 2-(2-bromo-3-hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 117498093 |
| Molecular Formula | C13H13BrO4 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 2-(2-bromo-3-hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl)-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)c1c(O)c(Br)cc2c1CCCCC2 |
| InChI | InChI=1S/C13H13BrO4/c14-9-6-7-4-2-1-3-5-8(7)10(11(9)15)12(16)13(17)18/h6,15H,1-5H2,(H,17,18) |
| InChIKey | ORBCCVOUEUDTQJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|