C15H20ClNO4 — CID 117498916
4-[5-chloro-3-methoxy-2-(1-methylazetidin-3-yl)oxyphenyl]butanoic acid (PubChem CID 117498916) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is 4-[5-chloro-3-methoxy-2-(1-methylazetidin-3-yl)oxyphenyl]butanoic acid.
| Compound Name | 4-[5-chloro-3-methoxy-2-(1-methylazetidin-3-yl)oxyphenyl]butanoic acid |
|---|---|
| PubChem CID | 117498916 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-[5-chloro-3-methoxy-2-(1-methylazetidin-3-yl)oxyphenyl]butanoic acid |
| SMILES | COc1cc(Cl)cc(CCCC(=O)O)c1OC1CN(C)C1 |
| InChI | InChI=1S/C15H20ClNO4/c1-17-8-12(9-17)21-15-10(4-3-5-14(18)19)6-11(16)7-13(15)20-2/h6-7,12H,3-5,8-9H2,1-2H3,(H,18,19) |
| InChIKey | LGWULWIYRVQMIH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |