C16H15BrN8 — CID 11749911
2-(6-bromo-2-pyridinyl)-2-[2-[3-(1,2,4-triazol-1-yl)propylamino]pyrimidin-4-yl]acetonitrile (PubChem CID 11749911) has the molecular formula C16H15BrN8 and a molecular weight of 399.26 g/mol. Its IUPAC name is 2-(6-bromo-2-pyridinyl)-2-[2-[3-(1,2,4-triazol-1-yl)propylamino]pyrimidin-4-yl]acetonitrile.
| Compound Name | 2-(6-bromo-2-pyridinyl)-2-[2-[3-(1,2,4-triazol-1-yl)propylamino]pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 11749911 |
| Molecular Formula | C16H15BrN8 |
| Molecular Weight | 399.26 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 2-(6-bromo-2-pyridinyl)-2-[2-[3-(1,2,4-triazol-1-yl)propylamino]pyrimidin-4-yl]acetonitrile |
| SMILES | N#CC(c1cccc(Br)n1)c1ccnc(NCCCn2cncn2)n1 |
| InChI | InChI=1S/C16H15BrN8/c17-15-4-1-3-13(23-15)12(9-18)14-5-7-21-16(24-14)20-6-2-8-25-11-19-10-22-25/h1,3-5,7,10-12H,2,6,8H2,(H,20,21,24) |
| InChIKey | IPKRVRPMTFXUHM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|