C15H16F2O5 — CID 117499983
ethyl 2-[7-(1,1-difluoroethyl)-3,4-dihydro-2H-1,5-benzodioxepin-8-yl]-2-oxoacetate (PubChem CID 117499983) has the molecular formula C15H16F2O5 and a molecular weight of 314.28 g/mol. Its IUPAC name is ethyl 2-[7-(1,1-difluoroethyl)-3,4-dihydro-2H-1,5-benzodioxepin-8-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[7-(1,1-difluoroethyl)-3,4-dihydro-2H-1,5-benzodioxepin-8-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 117499983 |
| Molecular Formula | C15H16F2O5 |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | ethyl 2-[7-(1,1-difluoroethyl)-3,4-dihydro-2H-1,5-benzodioxepin-8-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc2c(cc1C(C)(F)F)OCCCO2 |
| InChI | InChI=1S/C15H16F2O5/c1-3-20-14(19)13(18)9-7-11-12(22-6-4-5-21-11)8-10(9)15(2,16)17/h7-8H,3-6H2,1-2H3 |
| InChIKey | ZLPGZGKWNPVZJK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|