C26H24N2O3 — CID 11750270
methyl 5-(4-methylphenyl)-2,3a-diphenyl-4,6-dihydroimidazo[1,5-b][1,2]oxazole-3-carboxylate (PubChem CID 11750270) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is methyl 5-(4-methylphenyl)-2,3a-diphenyl-4,6-dihydroimidazo[1,5-b][1,2]oxazole-3-carboxylate.
| Compound Name | methyl 5-(4-methylphenyl)-2,3a-diphenyl-4,6-dihydroimidazo[1,5-b][1,2]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 11750270 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | methyl 5-(4-methylphenyl)-2,3a-diphenyl-4,6-dihydroimidazo[1,5-b][1,2]oxazole-3-carboxylate |
| SMILES | COC(=O)C1=C(c2ccccc2)ON2CN(c3ccc(C)cc3)CC12c1ccccc1 |
| InChI | InChI=1S/C26H24N2O3/c1-19-13-15-22(16-14-19)27-17-26(21-11-7-4-8-12-21)23(25(29)30-2)24(31-28(26)18-27)20-9-5-3-6-10-20/h3-16H,17-18H2,1-2H3 |
| InChIKey | MJGRDDYINTZJJT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|