C26H26N2O3 — CID 11750331
(Z)-3-(4-tert-butylphenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyridin-3-ylprop-2-enamide (PubChem CID 11750331) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is (Z)-3-(4-tert-butylphenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (Z)-3-(4-tert-butylphenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 11750331 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (Z)-3-(4-tert-butylphenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyridin-3-ylprop-2-enamide |
| SMILES | CC(C)(C)c1ccc(/C(=C/C(=O)Nc2ccc3c(c2)OCCO3)c2cccnc2)cc1 |
| InChI | InChI=1S/C26H26N2O3/c1-26(2,3)20-8-6-18(7-9-20)22(19-5-4-12-27-17-19)16-25(29)28-21-10-11-23-24(15-21)31-14-13-30-23/h4-12,15-17H,13-14H2,1-3H3,(H,28,29)/b22-16- |
| InChIKey | VGHIZBDGRLEHKV-JWGURIENSA-N |
| XLogP | 5.22 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|