C10H15F6N3O4S2 — CID 11750474
bis(trifluoromethylsulfonyl)azanide;1,2-dimethyl-3-propylimidazol-1-ium (PubChem CID 11750474) has the molecular formula C10H15F6N3O4S2 and a molecular weight of 419.37 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1,2-dimethyl-3-propylimidazol-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1,2-dimethyl-3-propylimidazol-1-ium |
|---|---|
| PubChem CID | 11750474 |
| Molecular Formula | C10H15F6N3O4S2 |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1,2-dimethyl-3-propylimidazol-1-ium |
| SMILES | CCCn1cc[n+](C)c1C.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H15N2.C2F6NO4S2/c1-4-5-10-7-6-9(3)8(10)2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h6-7H,4-5H2,1-3H3;/q+1;-1 |
| InChIKey | XOZHIVUWCICHSQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 91.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|