C24H25N3O4 — CID 11750484
3-[4-(dimethylamino)-3-[4-[(3-methylpyridine-4-carbonyl)amino]phenyl]phenoxy]propanoic acid (PubChem CID 11750484) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 3-[4-(dimethylamino)-3-[4-[(3-methylpyridine-4-carbonyl)amino]phenyl]phenoxy]propanoic acid.
| Compound Name | 3-[4-(dimethylamino)-3-[4-[(3-methylpyridine-4-carbonyl)amino]phenyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 11750484 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 3-[4-(dimethylamino)-3-[4-[(3-methylpyridine-4-carbonyl)amino]phenyl]phenoxy]propanoic acid |
| SMILES | Cc1cnccc1C(=O)Nc1ccc(-c2cc(OCCC(=O)O)ccc2N(C)C)cc1 |
| InChI | InChI=1S/C24H25N3O4/c1-16-15-25-12-10-20(16)24(30)26-18-6-4-17(5-7-18)21-14-19(31-13-11-23(28)29)8-9-22(21)27(2)3/h4-10,12,14-15H,11,13H2,1-3H3,(H,26,30)(H,28,29) |
| InChIKey | YQKJCMAWRUYOCY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|