C24H25N3O4 — CID 11750486
2-[[5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-yl]methoxy]-N,N-dimethylethanamine (PubChem CID 11750486) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-[[5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-yl]methoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[[5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-yl]methoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 11750486 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-[[5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-yl]methoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOCc1ccc(-c2nn(Cc3ccccc3)c3cc4c(cc23)OCO4)o1 |
| InChI | InChI=1S/C24H25N3O4/c1-26(2)10-11-28-15-18-8-9-21(31-18)24-19-12-22-23(30-16-29-22)13-20(19)27(25-24)14-17-6-4-3-5-7-17/h3-9,12-13H,10-11,14-16H2,1-2H3 |
| InChIKey | VBQDIOYCKKFLGQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|